HIV-1 inhibitor-31
Modify Date: 2025-08-21 22:44:13
HIV-1 inhibitor-31 structure
|
Common Name | HIV-1 inhibitor-31 | ||
|---|---|---|---|---|
| CAS Number | 920036-04-0 | Molecular Weight | 410.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H13Cl2N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HIV-1 inhibitor-31HIV-1 inhibitor-31 (compound 4) is a potent HIV-1 inhibitor. HIV-1 inhibitor-31 can be used for researching AIDS[1]. |
| Name | 3-chloro-5-[2-chloro-5-(2H-indazol-3-ylmethoxy)phenoxy]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | HIV-1 inhibitor-31 (compound 4) is a potent HIV-1 inhibitor. HIV-1 inhibitor-31 can be used for researching AIDS[1]. |
|---|---|
| Related Catalog | |
| Target |
HIV-1[1] |
| References |
| Molecular Formula | C21H13Cl2N3O2 |
|---|---|
| Molecular Weight | 410.25 |
| Exact Mass | 409.03800 |
| PSA | 70.93000 |
| LogP | 6.11268 |
| InChIKey | WHCLIFOVZDANCU-UHFFFAOYSA-N |
| SMILES | N#Cc1cc(Cl)cc(Oc2cc(OCc3[nH]nc4ccccc34)ccc2Cl)c1 |
| 3c6u |