ROCK-IN-5
Modify Date: 2025-08-26 18:40:40
ROCK-IN-5 structure
|
Common Name | ROCK-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 692870-25-0 | Molecular Weight | 347.79 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C16H11ClFN3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ROCK-IN-5ROCK-IN-5 (compound I-B-37) is a potent inhibitor of ROCK, ERK, GSK, and AGC protein kinases. ROCK-IN-5 has the potential for proliferative, cardiac and neurodegenerative diseases research[1]. |
| Name | WAY-658513 |
|---|---|
| Synonym | More Synonyms |
| Description | ROCK-IN-5 (compound I-B-37) is a potent inhibitor of ROCK, ERK, GSK, and AGC protein kinases. ROCK-IN-5 has the potential for proliferative, cardiac and neurodegenerative diseases research[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Molecular Formula | C16H11ClFN3OS |
| Molecular Weight | 347.79 |
| Exact Mass | 347.029541 |
| LogP | 3.11 |
| Index of Refraction | 1.662 |
| InChIKey | BPGUVXHQHDKSTA-UHFFFAOYSA-N |
| SMILES | O=C(Cc1c(F)cccc1Cl)Nc1nc(-c2ccncc2)cs1 |
| Benzeneacetamide, 2-chloro-6-fluoro-N-[4-(4-pyridinyl)-2-thiazolyl]- |
| 2-(2-Chloro-6-fluorophenyl)-N-[4-(4-pyridinyl)-1,3-thiazol-2-yl]acetamide |