NH2-PEG3-C2-Boc structure
|
Common Name | NH2-PEG3-C2-Boc | ||
|---|---|---|---|---|
| CAS Number | 252881-74-6 | Molecular Weight | 277.35700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H27NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.7ºC | |
Use of NH2-PEG3-C2-BocNH2-PEG3-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-butyl 3-[2-[2-(2-aminoethoxy)ethoxy]ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | NH2-PEG3-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1] |
| References |
| Molecular Formula | C13H27NO5 |
|---|---|
| Molecular Weight | 277.35700 |
| Flash Point | 169.7ºC |
| Exact Mass | 277.18900 |
| PSA | 80.01000 |
| LogP | 1.42700 |
| InChIKey | CWFSAZJIJBTKRC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCN |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26 |
| HS Code | 2922509090 |
|
~%
NH2-PEG3-C2-Boc CAS#:252881-74-6 |
| Literature: US2006/205670 A1, ; Page/Page column 105 ; |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| H2N-OEG-CO2tBu |
| tert-butyl 3-{2-[2-(2-aminoethoxy)ethoxy]ethoxy}propanoate |
| tert-Butyl 3-[2-(2-(2-aminoethoxy)ethoxy)ethoxy]propionate |
| NH2(CH2CH2O)3CH2CH2COOt-Bu |
| 12-amino-4,7,10-trioxadodecanoic acid tert-butyl ester |
| Amin PEG3-t-butyl ester |
| tert-butyl 12-amino-4,7,10-trioxododecanoate |
| tert-Butyl 12-amino-4,7,10-trioxadodecanoate |
| 3-[2-[2-(2-Aminoethoxy)ethoxy]ethoxy]propionic acid tert-butyl ester |