Azido-PEG5-amine structure
|
Common Name | Azido-PEG5-amine | ||
|---|---|---|---|---|
| CAS Number | 516493-93-9 | Molecular Weight | 306.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H26N4O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG5-amineAzido-PEG5-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-[2-[2-[2-[2-(2-azidoethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethanamine |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG5-amine is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C12H26N4O5 |
|---|---|
| Molecular Weight | 306.35900 |
| Exact Mass | 306.19000 |
| PSA | 121.92000 |
| LogP | 0.49146 |
| InChIKey | SVPBRIZYFJFLOL-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCOCCOCCOCCN |
| Storage condition | 2-8°C |
| 17-azido-3,6,9,12,15-pentaoxaheptadecanamine |
| 5-PEG amino azide |
| 17-azido-3,6,9,12,15-pentaoxa-1-heptadecylamine |
| 17-azide-3,6,9,12,15-pentaoxaheptadecan-1-amine |
| Azido-PEG5-Amine |
| 17-AZIDO-3,6,9,12,15-PENTAOXAHEPTADECAN-1-AMINE |
| 1-amino-17-azido-3,6,9,12,15-pentaoxaheptadecane |