eIF4E-IN-3
Modify Date: 2025-08-26 16:27:50
eIF4E-IN-3 structure
|
Common Name | eIF4E-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 2573979-29-8 | Molecular Weight | 711.15 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H30ClF3N6O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of eIF4E-IN-3eIF4E-IN-3 is a potent inhibitor of eukaryotic initiation factor 4e (eIF4e). eIF4E-IN-3 has the potential for researching eIF4e dependent diseases, including the research of cancer (extracted from patent WO2021003157A1, compound 485)[1]. |
| Name | eIF4E-IN-3 |
|---|
| Description | eIF4E-IN-3 is a potent inhibitor of eukaryotic initiation factor 4e (eIF4e). eIF4E-IN-3 has the potential for researching eIF4e dependent diseases, including the research of cancer (extracted from patent WO2021003157A1, compound 485)[1]. |
|---|---|
| Related Catalog | |
| Target |
eIF4e[1] |
| References |
| Molecular Formula | C34H30ClF3N6O4S |
|---|---|
| Molecular Weight | 711.15 |
| InChIKey | CZMVRWKBLXVZEA-UHFFFAOYSA-N |
| SMILES | Cc1cc(-c2cc(Cl)ccc2OCCn2c(C)nc3cc(C(F)(F)F)c(CN4CCN(C)CC4)c(C#N)c3c2=O)c2scc(C(=O)O)c2n1 |