t-Boc-N-amido-PEG3-thiol structure
|
Common Name | t-Boc-N-amido-PEG3-thiol | ||
|---|---|---|---|---|
| CAS Number | 1895922-68-5 | Molecular Weight | 309.422 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 419.4±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H27NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.5±27.3 °C | |
Use of t-Boc-N-amido-PEG3-thiolThiol-PEG3-NHBoc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl (2-{2-[2-(2-sulfanylethoxy)ethoxy]ethoxy}ethyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Description | Thiol-PEG3-NHBoc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 419.4±40.0 °C at 760 mmHg |
| Molecular Formula | C13H27NO5S |
| Molecular Weight | 309.422 |
| Flash Point | 207.5±27.3 °C |
| Exact Mass | 309.160980 |
| LogP | 1.10 |
| Vapour Pressure | 0.0±1.0 mmHg at 25°C |
| Index of Refraction | 1.472 |
| InChIKey | RWCUSUXTCYNDCV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NCCOCCOCCOCCS |
| 2-Methyl-2-propanyl (2-{2-[2-(2-sulfanylethoxy)ethoxy]ethoxy}ethyl)carbamate |
| MFCD29764342 |
| Carbamic acid, N-[2-[2-[2-(2-mercaptoethoxy)ethoxy]ethoxy]ethyl]-, 1,1-dimethylethyl ester |