Cbz-NH-PEG8-C2-acid
Modify Date: 2025-08-23 16:42:25
Cbz-NH-PEG8-C2-acid structure
|
Common Name | Cbz-NH-PEG8-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 1334177-87-5 | Molecular Weight | 575.646 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 681.2±55.0 °C at 760 mmHg | |
| Molecular Formula | C27H45NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 365.8±31.5 °C | |
Use of Cbz-NH-PEG8-C2-acidCbz-NH-PEG8-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-NH-PEG8-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 681.2±55.0 °C at 760 mmHg |
| Molecular Formula | C27H45NO12 |
| Molecular Weight | 575.646 |
| Flash Point | 365.8±31.5 °C |
| Exact Mass | 575.294189 |
| LogP | -0.96 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | ISVOBOLHCFBPFZ-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)OCc1ccccc1 |
| 3-Oxo-1-phenyl-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid |
| 2,7,10,13,16,19,22,25,28-Nonaoxa-4-azahentriacontan-31-oic acid, 3-oxo-1-phenyl- |