Cbz-NH-PEG2-C2-acid
Modify Date: 2025-08-26 09:57:48
Cbz-NH-PEG2-C2-acid structure
|
Common Name | Cbz-NH-PEG2-C2-acid | ||
|---|---|---|---|---|
| CAS Number | 1347750-76-8 | Molecular Weight | 311.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cbz-NH-PEG2-C2-acidCbz-NH-PEG2-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Cbz-N-amido-PEG2-acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-NH-PEG2-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H21NO6 |
|---|---|
| Molecular Weight | 311.33 |
| InChIKey | XOMNIRHPTPYIMF-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCNC(=O)OCc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|
| CBZ-N-AMIDO-PEG2-COOH |