CBZ-NH-PEG4-CH2CH2COOH
Modify Date: 2025-09-18 13:55:48
CBZ-NH-PEG4-CH2CH2COOH structure
|
Common Name | CBZ-NH-PEG4-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 756526-00-8 | Molecular Weight | 399.43546 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C19H29NO8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of CBZ-NH-PEG4-CH2CH2COOHCbz-NH-PEG4-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Z-15-aMino-4,7,10,13-tetraoxapentadecacanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Cbz-NH-PEG4-C2-acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C19H29NO8 |
|---|---|
| Molecular Weight | 399.43546 |
| InChIKey | QGTQYXJCFILXDO-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCNC(=O)OCc1ccccc1 |
| Hazard Codes | Xi |
|---|
| CBZ-NH-PEG4-CH2CH2COOH |