BDA-366
Modify Date: 2025-08-25 15:44:15
BDA-366 structure
|
Common Name | BDA-366 | ||
|---|---|---|---|---|
| CAS Number | 1909226-00-1 | Molecular Weight | 423.50 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 669.4±55.0 °C at 760 mmHg | |
| Molecular Formula | C24H29N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 358.6±31.5 °C | |
Use of BDA-366BDA-366 is a potent Bcl2 antagonist (Ki = 3.3 nM), binding Bcl2-BH4 domain with high affinity and selectivity. BDA-366 induces conformational change in Bcl2 that abrogates its antiapoptotic function, converting it from a survival molecule to a cell death inducer. BDA-366 suppresses growth of lung cancer cells[1]. |
| Name | BDA-366 |
|---|---|
| Synonym | More Synonyms |
| Description | BDA-366 is a potent Bcl2 antagonist (Ki = 3.3 nM), binding Bcl2-BH4 domain with high affinity and selectivity. BDA-366 induces conformational change in Bcl2 that abrogates its antiapoptotic function, converting it from a survival molecule to a cell death inducer. BDA-366 suppresses growth of lung cancer cells[1]. |
|---|---|
| Related Catalog | |
| Target |
Bcl-2:3.3 nM (Ki) |
| References |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 669.4±55.0 °C at 760 mmHg |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.50 |
| Flash Point | 358.6±31.5 °C |
| Exact Mass | 423.215820 |
| LogP | 2.18 |
| Vapour Pressure | 0.0±2.1 mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | JYOOEVFJWLBLKF-HOTGVXAUSA-N |
| SMILES | CCN(CC)CC(O)CNc1ccc(NCC2CO2)c2c1C(=O)c1ccccc1C2=O |
| Storage condition | -20℃ |
| 9,10-Anthracenedione, 1-[[(2S)-3-(diethylamino)-2-hydroxypropyl]amino]-4-[[(2S)-oxiranylmethyl]amino]- |
| BDA-366 |
| 1-{[(2S)-3-(Diethylamino)-2-hydroxypropyl]amino}-4-{[(2S)-2-oxiranylmethyl]amino}-9,10-anthraquinone |