Azido-PEG1-PFP ester
Modify Date: 2025-09-04 10:54:27
Azido-PEG1-PFP ester structure
|
Common Name | Azido-PEG1-PFP ester | ||
|---|---|---|---|---|
| CAS Number | 1807505-32-3 | Molecular Weight | 325.191 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H8F5N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG1-PFP esterAzido-PEG1-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG1-PFP ester |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG1-PFP ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C11H8F5N3O3 |
|---|---|
| Molecular Weight | 325.191 |
| Exact Mass | 325.048584 |
| LogP | 2.74 |
| InChIKey | MXTGUBUPWMDFOW-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCC(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| Pentafluorophenyl 3-(2-azidoethoxy)propanoate |
| MFCD26793775 |
| Propanoic acid, 3-(2-azidoethoxy)-, 2,3,4,5,6-pentafluorophenyl ester |