BnO-PEG1-CH2CO2tBu
Modify Date: 2025-08-25 13:32:14
BnO-PEG1-CH2CO2tBu structure
|
Common Name | BnO-PEG1-CH2CO2tBu | ||
|---|---|---|---|---|
| CAS Number | 1309451-06-6 | Molecular Weight | 266.33300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BnO-PEG1-CH2CO2tBuBnO-PEG1-CH2CO2tBu is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | tert-butyl 2-(2-(benzyloxy)ethoxy)acetate |
|---|---|
| Synonym | More Synonyms |
| Description | BnO-PEG1-CH2CO2tBu is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H22O4 |
|---|---|
| Molecular Weight | 266.33300 |
| Exact Mass | 266.15200 |
| PSA | 44.76000 |
| LogP | 2.56150 |
| InChIKey | VRDIGIWTGHNVCP-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)COCCOCc1ccccc1 |
| Storage condition | 2-8℃ |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:93206-09-8| MFCD28015768 |