Tos-PEG1-CH2-Boc
Modify Date: 2025-08-25 10:23:09
Tos-PEG1-CH2-Boc structure
|
Common Name | Tos-PEG1-CH2-Boc | ||
|---|---|---|---|---|
| CAS Number | 1643957-24-7 | Molecular Weight | 330.397 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 449.0±30.0 °C at 760 mmHg | |
| Molecular Formula | C15H22O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.4±24.6 °C | |
Use of Tos-PEG1-CH2-BocTos-PEG1-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Tos-PEG2-CH2CO2tBu |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG1-CH2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.0±30.0 °C at 760 mmHg |
| Molecular Formula | C15H22O6S |
| Molecular Weight | 330.397 |
| Flash Point | 225.4±24.6 °C |
| Exact Mass | 330.113708 |
| LogP | 2.93 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.503 |
| InChIKey | ASBZYPKOIDXKMT-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCC(=O)OC(C)(C)C)cc1 |
| Acetic acid, 2-[2-[[(4-methylphenyl)sulfonyl]oxy]ethoxy]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl (2-{[(4-methylphenyl)sulfonyl]oxy}ethoxy)acetate |
| MFCD28122953 |