NPEC-caged-(S)-AMPA
Modify Date: 2025-09-27 16:32:00
NPEC-caged-(S)-AMPA structure
|
Common Name | NPEC-caged-(S)-AMPA | ||
|---|---|---|---|---|
| CAS Number | 1257323-84-4 | Molecular Weight | 379.322 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 677.7±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H17N3O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 363.7±31.5 °C | |
Use of NPEC-caged-(S)-AMPANPEC- caged-(S)-AMPA, a caged neurotransmitter analog, is a NPEC photoprotecting group caged the (S)-AMPA (HY-100815A) to make caged ligands specific for glutamate receptor sub-types. NPEC- caged-(S)-AMPA selectively activates AMPA receptor[1]. |
| Name | 3-(5-Methyl-3-oxo-2,3-dihydro-1,2-oxazol-4-yl)-N-{[1-(2-nitrophenyl)ethoxy]carbonyl}-L-alanine |
|---|---|
| Synonym | More Synonyms |
| Description | NPEC- caged-(S)-AMPA, a caged neurotransmitter analog, is a NPEC photoprotecting group caged the (S)-AMPA (HY-100815A) to make caged ligands specific for glutamate receptor sub-types. NPEC- caged-(S)-AMPA selectively activates AMPA receptor[1]. |
|---|---|
| Related Catalog | |
| Target |
AMPA Receptor |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 677.7±55.0 °C at 760 mmHg |
| Molecular Formula | C16H17N3O8 |
| Molecular Weight | 379.322 |
| Flash Point | 363.7±31.5 °C |
| Exact Mass | 379.101563 |
| LogP | 2.10 |
| Vapour Pressure | 0.0±2.2 mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | LGVJRWDYNJZRRP-MYIOLCAUSA-N |
| SMILES | Cc1o[nH]c(=O)c1CC(NC(=O)OC(C)c1ccccc1[N+](=O)[O-])C(=O)O |
| 3-(5-Methyl-3-oxo-2,3-dihydro-1,2-oxazol-4-yl)-N-{[1-(2-nitrophenyl)ethoxy]carbonyl}-L-alanine |
| 4-Isoxazolepropanoic acid, 2,3-dihydro-5-methyl-α-[[[1-(2-nitrophenyl)ethoxy]carbonyl]amino]-3-oxo-, (αS)- |