Catestatin TFA
Modify Date: 2025-08-27 12:33:43
Catestatin TFA structure
|
Common Name | Catestatin TFA | ||
|---|---|---|---|---|
| CAS Number | 142211-96-9 | Molecular Weight | 2326.68000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C107H173N37O26S | Melting Point | N/A | |
| MSDS | Chinese USA | Flash Point | N/A | |
Use of Catestatin TFACatestatin is a 21-amino acid residue, cationic and hydrophobic peptide. Catestatin is an endogenous peptide that regulates cardiac function and blood pressure[1]. Catestatin is a non-competitive nicotinic antagonist acting through nicotinic acetylcholine receptors (nAChRs) to inhibit catecholamine release[2]. |
| Name | Catestatin |
|---|---|
| Synonym | More Synonyms |
| Description | Catestatin is a 21-amino acid residue, cationic and hydrophobic peptide. Catestatin is an endogenous peptide that regulates cardiac function and blood pressure[1]. Catestatin is a non-competitive nicotinic antagonist acting through nicotinic acetylcholine receptors (nAChRs) to inhibit catecholamine release[2]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C107H173N37O26S |
|---|---|
| Molecular Weight | 2326.68000 |
| Exact Mass | 2325.22000 |
| PSA | 988.77000 |
| LogP | 2.06660 |
| InChIKey | HCEYIDADOJWYIM-DIWOTYQXSA-N |
| SMILES | CSCCC(NC(=O)C(CO)NC(=O)C(N)CCCNC(=N)N)C(=O)NC(CCCNC(=N)N)C(=O)NC(CC(C)C)C(=O)NC(CO)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(=N)N)C(=O)NC(C)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)NC(Cc1ccc(O)cc1)C(=O)NCC(=O)NC(Cc1ccccc1)C(=O)NC(CCCNC(=N)N)C(=O)NCC(=O)N1CCCC1C(=O)NCC(=O)NC(CC(C)C)C(=O)NC(CCC(N)=O)C(=O)NC(CC(C)C)C(=O)O |
| NPEC-caged-D-AP5 |