NPEC-caged-(1S,3R)-ACPD
Modify Date: 2025-08-24 18:35:47
NPEC-caged-(1S,3R)-ACPD structure
|
Common Name | NPEC-caged-(1S,3R)-ACPD | ||
|---|---|---|---|---|
| CAS Number | 1315379-60-2 | Molecular Weight | 366.32 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 619.9±55.0 °C at 760 mmHg | |
| Molecular Formula | C16H18N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 328.7±31.5 °C | |
Use of NPEC-caged-(1S,3R)-ACPDNPEC-caged-(1S,3R)-ACPD is a specific photosensitive ligand for glutamate receptor subtypes. |
| Name | (1S,3R)-1-({[1-(2-Nitrophenyl)ethoxy]carbonyl}amino)-1,3-cyclopentanedicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Description | NPEC-caged-(1S,3R)-ACPD is a specific photosensitive ligand for glutamate receptor subtypes. |
|---|---|
| Related Catalog |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 619.9±55.0 °C at 760 mmHg |
| Molecular Formula | C16H18N2O8 |
| Molecular Weight | 366.32 |
| Flash Point | 328.7±31.5 °C |
| Exact Mass | 366.106323 |
| LogP | 1.40 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.609 |
| InChIKey | SKBDCZAPZZBWJU-XOXYBHGNSA-N |
| SMILES | CC(OC(=O)NC1(C(=O)O)CCC(C(=O)O)C1)c1ccccc1[N+](=O)[O-] |
| (1S,3R)-1-({[1-(2-Nitrophenyl)ethoxy]carbonyl}amino)-1,3-cyclopentanedicarboxylic acid |
| 1,3-Cyclopentanedicarboxylic acid, 1-[[[1-(2-nitrophenyl)ethoxy]carbonyl]amino]-, (1S,3R)- |