HO-PEG8-CH2CH2COOH
Modify Date: 2025-09-04 05:54:55
HO-PEG8-CH2CH2COOH structure
|
Common Name | HO-PEG8-CH2CH2COOH | ||
|---|---|---|---|---|
| CAS Number | 937188-60-8 | Molecular Weight | 442.49800 | |
| Density | 1.148±0.06 g/cm3 (20 °C, 760 mmHg) | Boiling Point | 554.3±50.0 °C (760 mmHg) | |
| Molecular Formula | C19H38O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HO-PEG8-CH2CH2COOHHO-PEG8-CH2CH2COOH (Hydroxy-PEG8-acid) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Propanoic acid, 3-[(23-hydroxy-3,6,9,12,15,18,21-heptaoxatricos-1-yl)oxy] |
|---|---|
| Synonym | More Synonyms |
| Description | HO-PEG8-CH2CH2COOH (Hydroxy-PEG8-acid) is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.148±0.06 g/cm3 (20 °C, 760 mmHg) |
|---|---|
| Boiling Point | 554.3±50.0 °C (760 mmHg) |
| Molecular Formula | C19H38O11 |
| Molecular Weight | 442.49800 |
| Exact Mass | 442.24100 |
| PSA | 131.37000 |
| InChIKey | BGBLNDCLYGWOKM-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCO |
| Hazard Codes | Xi |
|---|
| HO-PEG8-CH2CH2COOH |
| Alpha-hydroxy-ω-propionic acid octaethylene glycol |