Licochalcone E
Modify Date: 2025-08-27 16:30:13
Licochalcone E structure
|
Common Name | Licochalcone E | ||
|---|---|---|---|---|
| CAS Number | 864232-34-8 | Molecular Weight | 338.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C21H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Licochalcone ELicochalcone E, a flavonoid compound isolated from Glycyrrhiza inflate, inhibits NF-κB and AP-1 transcriptional activity through the inhibition of AKT and MAPK activation[1]. |
| Name | Licochalcone E |
|---|
| Description | Licochalcone E, a flavonoid compound isolated from Glycyrrhiza inflate, inhibits NF-κB and AP-1 transcriptional activity through the inhibition of AKT and MAPK activation[1]. |
|---|---|
| Related Catalog | |
| Target |
AKT, MAPK, NF-κB[1]. |
| References |
| Molecular Formula | C21H22O4 |
|---|---|
| Molecular Weight | 338.4 |
| InChIKey | SWPKMTGYQGHLJS-RNVIBTMRSA-N |
| SMILES | C=C(C)C(C)c1cc(C=CC(=O)c2ccc(O)cc2)c(OC)cc1O |