N,N'-Disuccinimidyl carbonate structure
|
Common Name | N,N'-Disuccinimidyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 74124-79-1 | Molecular Weight | 256.169 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 383.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H8N2O7 | Melting Point | 190 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 185.9±23.2 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | N,N'-Disuccinimidyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 383.7±25.0 °C at 760 mmHg |
| Melting Point | 190 °C (dec.)(lit.) |
| Molecular Formula | C9H8N2O7 |
| Molecular Weight | 256.169 |
| Flash Point | 185.9±23.2 °C |
| Exact Mass | 256.033142 |
| PSA | 110.29000 |
| LogP | -3.06 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.597 |
| InChIKey | PFYXSUNOLOJMDX-UHFFFAOYSA-N |
| SMILES | O=C(ON1C(=O)CCC1=O)ON1C(=O)CCC1=O |
| Storage condition | 2-8°C |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H315-H319-H335 |
| Precautionary Statements | P301 + P312 + P330-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Faceshields;Gloves |
| Hazard Codes | Xi:Irritant |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 29299000 |
|
~95%
N,N'-Disuccinim... CAS#:74124-79-1 |
| Literature: Konakahara; Ozaki; Sato; Gold Synthesis, 1993 , # 1 p. 103 - 106 |
|
~78%
N,N'-Disuccinim... CAS#:74124-79-1 |
| Literature: Ogura; Haruo Patent: US4341707 A1, 1982 ; |
| Precursor 3 | |
|---|---|
| DownStream 10 | |
| HS Code | 2925190090 |
|---|---|
| Summary | 2925190090 other imides and their derivatives; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Pharmacological inhibition of MIF interferes with trophoblast cell migration and invasiveness.
Placenta 36(2) , 150-9, (2015) Macrophage migration inhibitory factor (MIF) is expressed by villous and extravillous cytotrophoblast. This study was aimed to investigate functional relevance of MIF for human trophoblast.MIF mRNA an... |
|
|
Glassy-state stabilization of a dominant negative inhibitor anthrax vaccine containing aluminum hydroxide and glycopyranoside lipid A adjuvants.
J. Pharm. Sci. 104(2) , 627-39, (2015) During transport and storage, vaccines may be exposed to temperatures outside of the range recommended for storage, potentially causing efficacy losses. To better understand and prevent such losses, d... |
|
|
Curdlan-Conjugated PLGA Nanoparticles Possess Macrophage Stimulant Activity and Drug Delivery Capabilities.
Pharm. Res. 32 , 2713-26, (2015) There is significant interest in the application of nanoparticles to deliver immunostimulatory signals to cells. We hypothesized that curdlan (immune stimulating polymer) could be conjugated to PLGA a... |
| 1,1'-[Carbonylbis(oxy)]di(2,5-pyrrolidinedione) |
| bis(2,5-dioxopyrrolidin-1-yl) carbonate |
| MFCD00009767 |
| N,N'-Disuccinimidyl carbonate |
| 2,5-Pyrrolidinedione, 1,1'-[carbonylbis(oxy)]bis- |
| 1,1'-[Carbonylbis(oxy)]dipyrrolidine-2,5-dione |
| EINECS 277-730-3 |
| DISUCCINIMIDYL CARBONATE |
| DSC |
| N,N'-Disuccinimidylcarbonate |