2-(Methylsulfonyl)ethyl N-succinimidyl carbonate structure
|
Common Name | 2-(Methylsulfonyl)ethyl N-succinimidyl carbonate | ||
|---|---|---|---|---|
| CAS Number | 57903-15-8 | Molecular Weight | 265.240 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 458.5±47.0 °C at 760 mmHg | |
| Molecular Formula | C8H11NO7S | Melting Point | 115-118ºC(lit.) | |
| MSDS | N/A | Flash Point | 231.1±29.3 °C | |
Use of 2-(Methylsulfonyl)ethyl N-succinimidyl carbonate2-(Methylsulfonyl)ethyl n-succinimidyl carbonate is a protein crosslinker. 2-(Methylsulfonyl)ethyl n-succinimidyl carbonate has amino protective function[1]. |
| Name | (2,5-dioxopyrrolidin-1-yl) 2-methylsulfonylethyl carbonate |
|---|---|
| Synonym | More Synonyms |
| Description | 2-(Methylsulfonyl)ethyl n-succinimidyl carbonate is a protein crosslinker. 2-(Methylsulfonyl)ethyl n-succinimidyl carbonate has amino protective function[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 458.5±47.0 °C at 760 mmHg |
| Melting Point | 115-118ºC(lit.) |
| Molecular Formula | C8H11NO7S |
| Molecular Weight | 265.240 |
| Flash Point | 231.1±29.3 °C |
| Exact Mass | 265.025635 |
| PSA | 115.43000 |
| LogP | -2.22 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.533 |
| InChIKey | KSMLVLJMKBLJJL-UHFFFAOYSA-N |
| SMILES | CS(=O)(=O)CCOC(=O)ON1C(=O)CCC1=O |
| Water Solubility | Sparingly soluble (32 g/L) (25 ºC) |
| Hazard Codes | Xi |
|---|
|
~%
2-(Methylsulfon... CAS#:57903-15-8 |
| Literature: US2008/58348 A1, ; Page/Page column 51-52 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 1-({[2-(Methylsulfonyl)ethoxy]carbonyl}oxy)-2,5-pyrrolidinedione |
| 2-(Methylsulfonyl)ethyl N-succinimidyl carbonate |
| MSC-ONSu |
| 2-(Methanesulfonyl)ethyl succinimidyl carbonate |
| MFCD00043142 |
| N-[2-(Methylsulfonyl)ethoxycarbonyloxy]succinimide |
| 2,5-dioxoazolidinyl [2-(methylsulfonyl)ethoxy]formate |
| 1-(((2-(Methylsulfonyl)ethoxy)carbonyl)oxy)-2,5-pyrrolidinedione |
| 2-(Methylsulfonyl)ethyl succinimidyl carbonate |
| 1-({[2-(Methylsulfonyl)ethoxy]carbonyl}oxy)pyrrolidine-2,5-dione |
| 2,5-Pyrrolidinedione, 1-[[[2-(methylsulfonyl)ethoxy]carbonyl]oxy]- |
| 1-[[[2-(Methylsulfonyl)ethoxy]carbonyl]oxy]-2,5-pyrrolidinedione |