Pamoic acid disodium structure
|
Common Name | Pamoic acid disodium | ||
|---|---|---|---|---|
| CAS Number | 6640-22-8 | Molecular Weight | 432.333 | |
| Density | N/A | Boiling Point | 642.7ºC at 760 mmHg | |
| Molecular Formula | C23H14Na2O6 | Melting Point | 300 °C | |
| MSDS | N/A | Flash Point | 356.5ºC | |
Use of Pamoic acid disodiumPamoic acid disodium is a potent GPR35 agonist with an EC50 value of 79 nM. Pamoic acid disodium induces GPR35 internalization and activates ERK1/2 with EC50 values of 22 nM and 65 nM, respectively. Pamoic acid disodium potently recruits β-arrestin2 to GPR35 and has an antinociceptive effect[1]. |
| Name | disodium,3-carboxy-1-[(3-carboxy-2-oxidonaphthalen-1-yl)methyl]naphthalen-2-olate |
|---|---|
| Synonym | More Synonyms |
| Description | Pamoic acid disodium is a potent GPR35 agonist with an EC50 value of 79 nM. Pamoic acid disodium induces GPR35 internalization and activates ERK1/2 with EC50 values of 22 nM and 65 nM, respectively. Pamoic acid disodium potently recruits β-arrestin2 to GPR35 and has an antinociceptive effect[1]. |
|---|---|
| Related Catalog | |
| Target |
EC50: 79 nM (GPR35), 65 nM (ERK1/2)[1] |
| References |
| Boiling Point | 642.7ºC at 760 mmHg |
|---|---|
| Melting Point | 300 °C |
| Molecular Formula | C23H14Na2O6 |
| Molecular Weight | 432.333 |
| Flash Point | 356.5ºC |
| Exact Mass | 432.058563 |
| PSA | 120.72000 |
| LogP | 1.72200 |
| InChIKey | YGLLICRFEVEWOZ-UHFFFAOYSA-L |
| SMILES | O=C(O)c1cc2ccccc2c(Cc2c([O-])c(C(=O)O)cc3ccccc23)c1[O-].[Na+].[Na+] |
|
~%
Pamoic acid disodium CAS#:6640-22-8 |
| Literature: EP626170 A2, ; |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| Pamoic acid disodium salt |
| embonic acid disodium salt |
| MFCD00036183 |
| pamoate disodique |
| disodium 4,4'-methylene-bis(3-hydroxy-2-naphthoate) |
| dipotassium pamoate(2-) |
| sodium embonate |
| Disodium 4,4'-methylenebis(3-hydroxy-2-naphthoate) |
| Pamoic acid,disodium salt |
| PAMOIC ACID,Na |
| Sodium pamoate |
| disodium 4-[(3-carboxy-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylate |
| Disodium pamoate |
| disodium 4-[(3-carboxylato-2-hydroxynaphthalen-1-yl)methyl]-3-hydroxynaphthalene-2-carboxylate |
| 2-Naphthalenecarboxylic acid, 4,4'-methylenebis[3-hydroxy-, sodium salt (1:2) |
| Disodium methylenebis(2-hydroxy-3-naphthoate) |
| EINECS 229-653-1 |