HS-PEG4-CH2CH2COO<SUP>t</SUP>Bu
Modify Date: 2025-08-25 11:11:10
HS-PEG4-CH2CH2COO<SUP>t</SUP>Bu structure
|
Common Name | HS-PEG4-CH2CH2COO<SUP>t</SUP>Bu | ||
|---|---|---|---|---|
| CAS Number | 564476-33-1 | Molecular Weight | 282.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H30O6S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HS-PEG4-CH2CH2COO<SUP>t</SUP>BuThiol-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 1-Sulfanyl-3,6,9,12-tetraoxapentadecan-15-oic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Thiol-PEG4-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H30O6S |
|---|---|
| Molecular Weight | 282.35400 |
| Exact Mass | 282.11400 |
| PSA | 113.02000 |
| LogP | 0.45730 |
| InChIKey | NKLWGDQDZRFINM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCS |
| 15-mercapto-4,7,10,13-tetraoxapentadecanoic acid tert-butyl ester |
| 15-Keto-1-dehydro-testololacton |