HO-PEG5-CH2CH2COO<sup>t</sup>Bu
Modify Date: 2025-08-27 17:28:05
HO-PEG5-CH2CH2COO<sup>t</sup>Bu structure
|
Common Name | HO-PEG5-CH2CH2COO<sup>t</sup>Bu | ||
|---|---|---|---|---|
| CAS Number | 850090-09-4 | Molecular Weight | 366.44700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H34O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of HO-PEG5-CH2CH2COO<sup>t</sup>BuHydroxy-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl 1-hydroxy-3,6,9,12,15-pentaoxaoctadecan-18-oa te |
|---|---|
| Synonym | More Synonyms |
| Description | Hydroxy-PEG6-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C17H34O8 |
|---|---|
| Molecular Weight | 366.44700 |
| Exact Mass | 366.22500 |
| PSA | 92.68000 |
| LogP | 0.79350 |
| InChIKey | SNYKXOAOLAFMRH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCOCCOCCOCCO |
|
~81%
HO-PEG5-CH2CH2C... CAS#:850090-09-4 |
| Literature: Wosnick, Jordan H.; Mello, Charlene M.; Swager, Timothy M. Journal of the American Chemical Society, 2005 , vol. 127, # 10 p. 3400 - 3405 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 18-Hydroxy-19-norcorticosterone |
| 18-hydroxy-4,7,10,13,16-pentaoxaoctadecanoic acid tert-butyl ester |
| 18-OH-19-NC |