DOCK5-IN-C21 structure
|
Common Name | DOCK5-IN-C21 | ||
|---|---|---|---|---|
| CAS Number | 54129-15-6 | Molecular Weight | 302.17600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9Cl2NO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DOCK5-IN-C21DOCK5-IN-C21 is an allosteric inhibitor of the guanine nucleotide exchange factor DOCK5. |
| Name | N-(3,5-dichlorophenyl)benzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9Cl2NO2S |
|---|---|
| Molecular Weight | 302.17600 |
| Exact Mass | 300.97300 |
| PSA | 54.55000 |
| LogP | 4.94800 |
| InChIKey | HMKZVAZQKOKXRZ-UHFFFAOYSA-N |
| SMILES | O=S(=O)(Nc1cc(Cl)cc(Cl)c1)c1ccccc1 |
|
~49%
DOCK5-IN-C21 CAS#:54129-15-6 |
| Literature: CAMBRIA PHARMACEUTICALS, INC.; NORTHWESTERN UNIVERSITY; KIRSCH, Donald, R.; BENMOHAMED, Radhia; ARVANITES, Anthony, C.; MORIMOTO, Richard, I.; CHEN, Tian; SILVERMAN, Richard, B. Patent: WO2010/59241 A2, 2010 ; Location in patent: Page/Page column 118 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Benzolsulfonsaeure-(3,5-dichlor-anilid) |
| N-(3,5-dichlorophenyl)benzensulfonamide |
| benzenesulfonic acid-(3,5-dichloro-anilide) |