ATR-IN-4
Modify Date: 2025-08-27 10:32:44
ATR-IN-4 structure
|
Common Name | ATR-IN-4 | ||
|---|---|---|---|---|
| CAS Number | 2574545-45-0 | Molecular Weight | 364.40 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H20N8O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of ATR-IN-4ATR-IN-4 is a potent ATR (Ataxia telangiectasia mutated gene Rad 3-associated kinase) inhibitor. ATR-IN-4 inhibits growth of human prostate cancer cells DU145 and human lung cancer cells NCI-H460 with IC50s of 130.9 nM and 41 .33 nM, respectively. (Patent CN112142744A, compound 13)[1]. |
| Name | ATR-IN-4 |
|---|
| Description | ATR-IN-4 is a potent ATR (Ataxia telangiectasia mutated gene Rad 3-associated kinase) inhibitor. ATR-IN-4 inhibits growth of human prostate cancer cells DU145 and human lung cancer cells NCI-H460 with IC50s of 130.9 nM and 41 .33 nM, respectively. (Patent CN112142744A, compound 13)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H20N8O |
|---|---|
| Molecular Weight | 364.40 |
| InChIKey | BUTVLOCHWATRAS-GFCCVEGCSA-N |
| SMILES | CC1COCCN1c1cc(-c2ccnn2C)c2cnc(-c3ccn[nH]3)n2n1 |