Mal-C2-cyclohexylcarboxyl-hydrazide TFA
Modify Date: 2024-01-08 16:24:33
Mal-C2-cyclohexylcarboxyl-hydrazide TFA structure
|
Common Name | Mal-C2-cyclohexylcarboxyl-hydrazide TFA | ||
|---|---|---|---|---|
| CAS Number | 359436-59-2 | Molecular Weight | 365.305 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18F3N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-C2-cyclohexylcarboxyl-hydrazide TFAMal-C2-cyclohexylcarboxyl-hydrazide (TFA) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 4-[(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]cyclohexanecarbohydrazide trifluoroacetate (1:1) |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-C2-cyclohexylcarboxyl-hydrazide (TFA) is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C14H18F3N3O5 |
|---|---|
| Molecular Weight | 365.305 |
| Exact Mass | 365.119843 |
| InChIKey | QZSWNSOSRFZSEX-UHFFFAOYSA-N |
| SMILES | NNC(=O)C1CCC(CN2C(=O)C=CC2=O)CC1.O=C(O)C(F)(F)F |
| MFCD01863409 |
| 4-[(2,5-Dioxo-2,5-dihydro-1H-pyrrol-1-yl)methyl]cyclohexanecarbohydrazide trifluoroacetate (1:1) |