Mal-peg2-t-butyl ester
Modify Date: 2025-08-27 16:22:44
Mal-peg2-t-butyl ester structure
|
Common Name | Mal-peg2-t-butyl ester | ||
|---|---|---|---|---|
| CAS Number | 1374666-31-5 | Molecular Weight | 313.35 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H23NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mal-peg2-t-butyl esterMal-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Mal-PEG2-C2-Boc |
|---|---|
| Synonym | More Synonyms |
| Description | Mal-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C15H23NO6 |
|---|---|
| Molecular Weight | 313.35 |
| InChIKey | XWPBPQDTQUEMBX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCN1C(=O)C=CC1=O |
| MFCD23726621 |