EGFR-IN-30 structure
|
Common Name | EGFR-IN-30 | ||
|---|---|---|---|---|
| CAS Number | 2726463-68-7 | Molecular Weight | 610.49 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C28H33BrN7O2P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EGFR-IN-30EGFR-IN-30 is a potent EGFR inhibitor with IC50s of 1-10 nM, <1 nM for EGFR (WT), EGFR (L858R/T790M/C797S), respectively. EGFR-IN-30 has potential for cell proliferative diseases, such as cancer research[1]. |
| Name | EGFR-IN-30 |
|---|
| Description | EGFR-IN-30 is a potent EGFR inhibitor with IC50s of 1-10 nM, <1 nM for EGFR (WT), EGFR (L858R/T790M/C797S), respectively. EGFR-IN-30 has potential for cell proliferative diseases, such as cancer research[1]. |
|---|---|
| Related Catalog | |
| Target |
EGFR (WT):1-10 nM (IC50) EGFR (L858R/T790M/C797S):<1 nM (IC50) |
| In Vitro | EGFR-IN-30 (compound 27) inhibits A431 cell (IC50=100-1000 nM),Ba/F3_L858R/T790M/C797S cell (IC50<10 nM), Ba/F3_Del19/T790M/C797S cell (IC50<10 nM)[1]. |
| References |
[1]. Shansong Zheng, et al. Tricyclic compounds as EGFR inhibitors. WO2021208918A1. |
| Molecular Formula | C28H33BrN7O2P |
|---|---|
| Molecular Weight | 610.49 |
| InChIKey | GPRZWEDMKSTCPZ-UHFFFAOYSA-N |
| SMILES | COc1cc2c(cc1Nc1ncc(Br)c(Nc3ccccc3P(C)(C)=O)n1)-c1cnn(C)c1CCN2C(C)C |