OICR-9429-N-C2-NH2
Modify Date: 2025-08-25 10:06:10
OICR-9429-N-C2-NH2 structure
|
Common Name | OICR-9429-N-C2-NH2 | ||
|---|---|---|---|---|
| CAS Number | 2407457-55-8 | Molecular Weight | 597.67 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H38F3N7O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of OICR-9429-N-C2-NH2OICR-9429-N-C2-NH2 is a ligand for Wd40 repeat domain protein 5 (WDR5) extracted from patent WO2019246570A1, intermediate 2. OICR-9429-N-C2-NH2 can be used in the synthesis of PROTACs[1]. |
| Name | OICR-9429-N-C2-NH2 |
|---|
| Description | OICR-9429-N-C2-NH2 is a ligand for Wd40 repeat domain protein 5 (WDR5) extracted from patent WO2019246570A1, intermediate 2. OICR-9429-N-C2-NH2 can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Ligand for Target Protein for PROTAC[1] |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[2]. |
| References |
| Molecular Formula | C31H38F3N7O2 |
|---|---|
| Molecular Weight | 597.67 |
| InChIKey | XQJRWIQMMZCHHF-UHFFFAOYSA-N |
| SMILES | CN1CCN(c2ccc(-c3cccc(CN4CCN(CCN)CC4)c3)cc2NC(=O)c2c[nH]c(=O)cc2C(F)(F)F)CC1 |
| Storage condition | 2-8°C |