eIF4A3-IN-5
Modify Date: 2025-08-25 12:45:12
eIF4A3-IN-5 structure
|
Common Name | eIF4A3-IN-5 | ||
|---|---|---|---|---|
| CAS Number | 2100145-31-9 | Molecular Weight | 474.46 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H22N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of eIF4A3-IN-5eIF4A3-IN-5 is a potent inhibitor of eukaryotic initiation factor 4A (eIF4A), such as eIF4AI and eIF4AII. eIF4A3-IN-5 has the potential for the research of eIF4A dependent diseases, including the research of cancer (extracted from patent US20170145026A1)[1]. |
| Name | eIF4A3-IN-5 |
|---|
| Description | eIF4A3-IN-5 is a potent inhibitor of eukaryotic initiation factor 4A (eIF4A), such as eIF4AI and eIF4AII. eIF4A3-IN-5 has the potential for the research of eIF4A dependent diseases, including the research of cancer (extracted from patent US20170145026A1)[1]. |
|---|---|
| Related Catalog | |
| Target |
eIF4A[1] |
| References |
| Molecular Formula | C26H22N2O7 |
|---|---|
| Molecular Weight | 474.46 |
| InChIKey | UADSEUZFIUVZDF-YHVMUTAASA-N |
| SMILES | COc1cc2c(c(OC)n1)C1(O)C(O)C(C(=O)O)C(c3ccccc3)C1(c1ccc(C#N)cc1)O2 |