Mcl1-IN-3
Modify Date: 2025-08-27 15:27:20
Mcl1-IN-3 structure
|
Common Name | Mcl1-IN-3 | ||
|---|---|---|---|---|
| CAS Number | 1814891-79-6 | Molecular Weight | 487.93 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H22ClN3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Mcl1-IN-3Mcl1-IN-3 is an inhibitor of Mcl1 extracted from patent WO2015153959A2, compound example 57; has an IC50 and Ki of 0.67 and 0.13 μM, respectively. |
| Name | Mcl1-IN-3 |
|---|
| Description | Mcl1-IN-3 is an inhibitor of Mcl1 extracted from patent WO2015153959A2, compound example 57; has an IC50 and Ki of 0.67 and 0.13 μM, respectively. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.67 μM (Mcl1)[1] Ki: 0.13 μM (Mcl1)[1] |
| References |
| Molecular Formula | C27H22ClN3O4 |
|---|---|
| Molecular Weight | 487.93 |
| InChIKey | LTAWGVCXLNOXJX-UHFFFAOYSA-N |
| SMILES | Cc1cc(Oc2ccc(Cn3nc(C)c4c(C(=O)O)cc(-c5ccco5)nc43)cc2)cc(C)c1Cl |