Donitriptan structure
|
Common Name | Donitriptan | ||
|---|---|---|---|---|
| CAS Number | 170912-52-4 | Molecular Weight | 403.47700 | |
| Density | 1.32g/cm3 | Boiling Point | 727.1ºC at 760mmHg | |
| Molecular Formula | C23H25N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 393.6ºC | |
Use of DonitriptanDonitriptan is a potent, high efficacy agonist at 5-HT1B/1D receptors with pKis of 9.4 and 9.3, respectively[1]. |
| Name | 4-[4-[2-[[3-(2-aminoethyl)-1H-indol-5-yl]oxy]acetyl]piperazin-1-yl]benzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | Donitriptan is a potent, high efficacy agonist at 5-HT1B/1D receptors with pKis of 9.4 and 9.3, respectively[1]. |
|---|---|
| Related Catalog | |
| Target |
5-HT1B Receptor:9.4 (pKi) 5-HT1D Receptor:9.3 (pKi) |
| References |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 727.1ºC at 760mmHg |
| Molecular Formula | C23H25N5O2 |
| Molecular Weight | 403.47700 |
| Flash Point | 393.6ºC |
| Exact Mass | 403.20100 |
| PSA | 98.38000 |
| LogP | 2.97158 |
| Vapour Pressure | 5.34E-21mmHg at 25°C |
| Index of Refraction | 1.688 |
| InChIKey | SOHCKWZVTCTQBG-UHFFFAOYSA-N |
| SMILES | N#Cc1ccc(N2CCN(C(=O)COc3ccc4[nH]cc(CCN)c4c3)CC2)cc1 |
| Donitriptan |