Tos-PEG3-CH2COOtBu
Modify Date: 2025-08-25 16:31:18
Tos-PEG3-CH2COOtBu structure
|
Common Name | Tos-PEG3-CH2COOtBu | ||
|---|---|---|---|---|
| CAS Number | 1530778-24-5 | Molecular Weight | 418.502 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 517.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H30O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 266.9±28.7 °C | |
Use of Tos-PEG3-CH2COOtBuTos-PEG3-CH2COOtBu is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl {2-[2-(2-{[(4-methylphenyl)sulfonyl]oxy}ethoxy)ethoxy]ethoxy}acetate |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG3-CH2COOtBu is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 517.7±45.0 °C at 760 mmHg |
| Molecular Formula | C19H30O8S |
| Molecular Weight | 418.502 |
| Flash Point | 266.9±28.7 °C |
| Exact Mass | 418.166138 |
| LogP | 2.22 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.496 |
| InChIKey | GAURGLGHXALBCV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCC(=O)OC(C)(C)C)cc1 |
| Acetic acid, 2-[2-[2-[2-[[(4-methylphenyl)sulfonyl]oxy]ethoxy]ethoxy]ethoxy]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl {2-[2-(2-{[(4-methylphenyl)sulfonyl]oxy}ethoxy)ethoxy]ethoxy}acetate |