5-Acetylsalicylic acid structure
|
Common Name | 5-Acetylsalicylic acid | ||
|---|---|---|---|---|
| CAS Number | 13110-96-8 | Molecular Weight | 180.15700 | |
| Density | 1.365 g/cm3 | Boiling Point | 413ºC at 760 mmHg | |
| Molecular Formula | C9H8O4 | Melting Point | 214-216°C | |
| MSDS | USA | Flash Point | 250°C | |
Use of 5-Acetylsalicylic acid5-Acetylsalicylic acid has anti-inflammatory and is considered to be the active agent in inflammatory bowel disease (IBD)[1]. |
| Name | 5-Acetylsalicylic Acid |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Acetylsalicylic acid has anti-inflammatory and is considered to be the active agent in inflammatory bowel disease (IBD)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.365 g/cm3 |
|---|---|
| Boiling Point | 413ºC at 760 mmHg |
| Melting Point | 214-216°C |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.15700 |
| Flash Point | 250°C |
| Exact Mass | 180.04200 |
| PSA | 74.60000 |
| LogP | 1.29300 |
| Vapour Pressure | 1.46E-07mmHg at 25°C |
| InChIKey | NZRDKNBIPVLNHA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc(O)c(C(=O)O)c1 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-ACETYLSALICYLIC ACID |
| MFCD00013978 |
| 5-acetyl-2-hydroxybenzoic acid |
| EINECS 236-037-6 |