(2Z)-2-(3-carboxy-4-oxo-1-cyclohexa-2,5-dienylidene)-1H-quinoline-4-carboxylic acid
Modify Date: 2025-09-13 17:03:50
(2Z)-2-(3-carboxy-4-oxo-1-cyclohexa-2,5-dienylidene)-1H-quinoline-4-carboxylic acid structure
|
Common Name | (2Z)-2-(3-carboxy-4-oxo-1-cyclohexa-2,5-dienylidene)-1H-quinoline-4-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 525-48-4 | Molecular Weight | 309.27300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H11NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(p-Hydroxyphenyl)quinoline-4,3'-dicarboxylic acid |
|---|
| Molecular Formula | C17H11NO5 |
|---|---|
| Molecular Weight | 309.27300 |
| Exact Mass | 309.06400 |
| PSA | 107.72000 |
| LogP | 3.00380 |
| Index of Refraction | 1.735 |
| InChIKey | KIWASCBIBBHEML-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(-c2cc(C(=O)O)c3ccccc3n2)ccc1O |
| HS Code | 2933499090 |
|---|
|
~%
(2Z)-2-(3-carbo... CAS#:525-48-4 |
| Literature: Hoechster Farbw. Patent: DE293467 ; |
|
~%
(2Z)-2-(3-carbo... CAS#:525-48-4 |
| Literature: Hoechster Farbw. Patent: DE293467 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 12, p. 727 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |