Benzoic acid,2-(acetyloxy)-5-bromo- structure
|
Common Name | Benzoic acid,2-(acetyloxy)-5-bromo- | ||
|---|---|---|---|---|
| CAS Number | 1503-53-3 | Molecular Weight | 259.05300 | |
| Density | 1.662g/cm3 | Boiling Point | 368.4ºC at 760mmHg | |
| Molecular Formula | C9H7BrO4 | Melting Point | 60 °C | |
| MSDS | N/A | Flash Point | 176.6ºC | |
| Name | 2-acetyloxy-5-bromobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.662g/cm3 |
|---|---|
| Boiling Point | 368.4ºC at 760mmHg |
| Melting Point | 60 °C |
| Molecular Formula | C9H7BrO4 |
| Molecular Weight | 259.05300 |
| Flash Point | 176.6ºC |
| Exact Mass | 257.95300 |
| PSA | 63.60000 |
| LogP | 2.07260 |
| Vapour Pressure | 4.46E-06mmHg at 25°C |
| Index of Refraction | 1.585 |
| InChIKey | VRJBEVQGJOSGOX-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(Br)cc1C(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2918990090 |
|---|
|
~86%
Benzoic acid,2-... CAS#:1503-53-3 |
| Literature: Sharma, Horrick; Patil, Shivaputra; Sanchez, Tino W.; Neamati, Nouri; Schinazi, Raymond F.; Buolamwini, John K. Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 6 p. 2030 - 2045 |
|
~87%
Benzoic acid,2-... CAS#:1503-53-3 |
| Literature: Kowa Co., Ltd. Patent: US6136848 A1, 2000 ; |
|
~96%
Benzoic acid,2-... CAS#:1503-53-3 |
| Literature: TRANSTECH PHARMA, INC. Patent: WO2004/14844 A2, 2004 ; Location in patent: Page 203 ; WO 2004/014844 A2 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 5-bromo-2-acetoxybenzoic acid |
| 5-Bromosalicylic acid acetate |
| 2-Acetoxy-5-brom-benzoesaeure |
| 5-Bromo-2-acetylsalicylic acid |
| 5-bromoaspirin |
| 5-Bromoacetylsalicylic acid |
| 2-Acetoxy-5-bromobenzoic acid |
| Sedasprin |
| Bromoaspirin |
| acetyl-5-bromosalicylic acid |