Azido-PEG2-C2-Boc
Modify Date: 2025-08-26 10:58:39
Azido-PEG2-C2-Boc structure
|
Common Name | Azido-PEG2-C2-Boc | ||
|---|---|---|---|---|
| CAS Number | 1271728-79-0 | Molecular Weight | 259.302 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H21N3O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG2-C2-BocAzido-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl 3-[2-(2-azidoethoxy)ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Azido-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C11H21N3O4 |
|---|---|
| Molecular Weight | 259.302 |
| Exact Mass | 259.153198 |
| LogP | 1.34 |
| InChIKey | LSMDUZQBNBZFEA-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCN=[N+]=[N-] |
| Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-[2-(2-azidoethoxy)ethoxy]propanoate |