Tos-PEG2-C2-Boc
Modify Date: 2025-08-26 19:39:03
Tos-PEG2-C2-Boc structure
|
Common Name | Tos-PEG2-C2-Boc | ||
|---|---|---|---|---|
| CAS Number | 850090-13-0 | Molecular Weight | 388.476 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 495.2±35.0 °C at 760 mmHg | |
| Molecular Formula | C18H28O7S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.3±25.9 °C | |
Use of Tos-PEG2-C2-BocTos-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-Methyl-2-propanyl 3-[2-(2-{[(4-methylphenyl)sulfonyl]oxy}ethoxy)ethoxy]propanoate |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs Alkyl/ether |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.2±35.0 °C at 760 mmHg |
| Molecular Formula | C18H28O7S |
| Molecular Weight | 388.476 |
| Flash Point | 253.3±25.9 °C |
| Exact Mass | 388.155579 |
| LogP | 2.45 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.498 |
| InChIKey | ATHTXRBMNTZSMB-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCC(=O)OC(C)(C)C)cc1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xn |
|---|
| Propanoic acid, 3-[2-[2-[[(4-methylphenyl)sulfonyl]oxy]ethoxy]ethoxy]-, 1,1-dimethylethyl ester |
| 2-Methyl-2-propanyl 3-[2-(2-{[(4-methylphenyl)sulfonyl]oxy}ethoxy)ethoxy]propanoate |
| MFCD27635184 |
| Tos-PEG2-C2-Boc |