Ald-Ph-amido-PEG2-C2-Boc
Modify Date: 2025-09-04 20:29:27
Ald-Ph-amido-PEG2-C2-Boc structure
|
Common Name | Ald-Ph-amido-PEG2-C2-Boc | ||
|---|---|---|---|---|
| CAS Number | 1807521-09-0 | Molecular Weight | 365.421 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 547.6±45.0 °C at 760 mmHg | |
| Molecular Formula | C19H27NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.0±28.7 °C | |
Use of Ald-Ph-amido-PEG2-C2-BocAld-Ph-amido-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Ald-Ph-PEG2-t-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Description | Ald-Ph-amido-PEG2-C2-Boc is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 547.6±45.0 °C at 760 mmHg |
| Molecular Formula | C19H27NO6 |
| Molecular Weight | 365.421 |
| Flash Point | 285.0±28.7 °C |
| Exact Mass | 365.183838 |
| LogP | 1.86 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.520 |
| InChIKey | UXMPBIQFYCJYBB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)CCOCCOCCNC(=O)c1ccc(C=O)cc1 |
| ALD-PH-PEG2-CH2CH2COOTBU |