Tos-PEG9-Tos
Modify Date: 2025-08-25 19:03:11
Tos-PEG9-Tos structure
|
Common Name | Tos-PEG9-Tos | ||
|---|---|---|---|---|
| CAS Number | 109635-64-5 | Molecular Weight | 722.86100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C32H50O14S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tos-PEG9-TosTos-PEG9-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Nonaethylene glycol ditosylate |
|---|
| Description | Tos-PEG9-Tos is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C32H50O14S2 |
|---|---|
| Molecular Weight | 722.86100 |
| Exact Mass | 722.26400 |
| PSA | 177.34000 |
| LogP | 4.70860 |
| InChIKey | SIKNYSIQTXQRSQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)c2ccc(C)cc2)cc1 |