Tos-PEG9 structure
|
Common Name | Tos-PEG9 | ||
|---|---|---|---|---|
| CAS Number | 62573-11-9 | Molecular Weight | 568.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C25H44O12S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Tos-PEG9Tos-PEG9 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | nonaethyleneglycol mono(p-toluenesulfonyl) ether |
|---|---|
| Synonym | More Synonyms |
| Description | Tos-PEG9 is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C25H44O12S |
|---|---|
| Molecular Weight | 568.67500 |
| Exact Mass | 568.25500 |
| PSA | 145.82000 |
| LogP | 1.90620 |
| InChIKey | IJODQQRFMNRBNF-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)OCCOCCOCCOCCOCCOCCOCCOCCOCCO)cc1 |
| 26-hydroxy-3,6,9,12,15,18,21,24-octaoxahexacosyl p-toluenesulfonate |