β-Sitosterol acetate structure
|
Common Name | β-Sitosterol acetate | ||
|---|---|---|---|---|
| CAS Number | 915-05-9 | Molecular Weight | 456.74 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 514.5±29.0 °C at 760 mmHg | |
| Molecular Formula | C31H52O2 | Melting Point | 133ºC | |
| MSDS | N/A | Flash Point | 262.1±11.8 °C | |
Use of β-Sitosterol acetateβ-Sitosterol acetate (contains Campesterol acetate) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
| Name | β-sitosterol 3-O-acetate |
|---|---|
| Synonym | More Synonyms |
| Description | β-Sitosterol acetate (contains Campesterol acetate) is a biochemical reagent that can be used as a biological material or organic compound for life science related research. |
|---|---|
| Related Catalog |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 514.5±29.0 °C at 760 mmHg |
| Melting Point | 133ºC |
| Molecular Formula | C31H52O2 |
| Molecular Weight | 456.74 |
| Flash Point | 262.1±11.8 °C |
| Exact Mass | 456.396729 |
| PSA | 26.30000 |
| LogP | 11.58 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.513 |
| InChIKey | PBWOIPCULUXTNY-LBKBYZTLSA-N |
| SMILES | CCC(CCC(C)C1CCC2C3CC=C4CC(OC(C)=O)CCC4(C)C3CCC12C)C(C)C |
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| EINECS 213-019-6 |
| beta-sitosterol 3-O-acetate |
| Stigmast-5-en-3β-yl acetate |
| SITOSTEROL ACETATE |
| Stigmast-5-en-3-ol, acetate, (3β,20R,24R)- |
| β-Sitosterol Acetate (contains Campesterol) |
| 3β-Acetoxystigmast-5-ene |
| (3β,20R,24R)-Stigmast-5-en-3-yl acetate |
| stigmast-5-en-3-ol, acetate, (3β,24R)- |
| β-Sitosterol acetate |
| Stigmast-5-en-3β-ol, acetate |
| MFCD00083497 |
| (3β,24R)-Stigmast-5-en-3-yl acetate |
| (3β)-Stigmast-5-en-3-yl acetate |
| Stigmast-5-en-3-ol, acetate, (3β)- |