Biotin-C5-amino-C5-amino
Modify Date: 2025-08-21 11:27:18
Biotin-C5-amino-C5-amino structure
|
Common Name | Biotin-C5-amino-C5-amino | ||
|---|---|---|---|---|
| CAS Number | 89889-51-0 | Molecular Weight | 470.62600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H38N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-C5-amino-C5-aminoBiotin-C5-amino-C5-amino is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 6-[6-[5-[(3aS,4S,6aR)-2-oxo-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-4-yl]pentanoylamino]hexanoylamino]hexanoic acid |
|---|---|
| Synonym | More Synonyms |
| Description | Biotin-C5-amino-C5-amino is an alkyl chain-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
Alkyl-Chain |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C22H38N4O5S |
|---|---|
| Molecular Weight | 470.62600 |
| Exact Mass | 470.25600 |
| PSA | 172.40000 |
| LogP | 3.79940 |
| InChIKey | SRKRKWYAHKIBEW-FIKGOQFSSA-N |
| SMILES | O=C(O)CCCCCNC(=O)CCCCCNC(=O)CCCCC1SCC2NC(=O)NC21 |
| Storage condition | 2-8°C |
|
~%
Biotin-C5-amino... CAS#:89889-51-0 |
| Literature: Plaziuk, Damian; Zakrzewski, Janusz; Salmain, Michele; Blauzi, Andrzej; Rychlik, Blaziej; Strzelczyk, Pawel; Bujacz, Anna; Bujacz, Grzegorz Organometallics, 2013 , vol. 32, # 20 p. 5774 - 5783 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| D-biotinylaminohexanoylaminohexanoic acid |
| D-biotin-Acp-Acp-OH |
| N-Biotinylcaproylaminocaproic Acid |