Biotin-C5-Azide structure
|
Common Name | Biotin-C5-Azide | ||
|---|---|---|---|---|
| CAS Number | 1260586-88-6 | Molecular Weight | 255.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H17N5OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Biotin-C5-AzideBiotin-C5-Azide (DecarboxyBiotin-N3) is a biotin reagent and can be used to prepare biotinylated conjugates. |
| Name | Biotin-C5-Azide |
|---|
| Description | Biotin-C5-Azide (DecarboxyBiotin-N3) is a biotin reagent and can be used to prepare biotinylated conjugates. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C10H17N5OS |
|---|---|
| Molecular Weight | 255.34 |
| InChIKey | CSDCRNNAOYVBRW-CIUDSAMLSA-N |
| SMILES | [N-]=[N+]=NCCCCCC1SCC2NC(=O)NC21 |