Fmoc-N-amido-PEG8-acid structure
|
Common Name | Fmoc-N-amido-PEG8-acid | ||
|---|---|---|---|---|
| CAS Number | 756526-02-0 | Molecular Weight | 663.75200 | |
| Density | 1.190±0.06 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C34H49NO12 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Fmoc-N-amido-PEG8-acidFmoc-NH-PEG8-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
| Name | Fmoc-NH-PEG8-CH2CH2COOH |
|---|---|
| Synonym | More Synonyms |
| Description | Fmoc-NH-PEG8-CH2CH2COOH is a cleavable ADC linker used in the synthesis of antibody-drug conjugates (ADCs)[1]. |
|---|---|
| Related Catalog | |
| Target |
Cleavable |
| In Vitro | ADCs are comprised of an antibody to which is attached an ADC cytotoxin through an ADC linker. |
| References |
| Density | 1.190±0.06 g/cm3 |
|---|---|
| Molecular Formula | C34H49NO12 |
| Molecular Weight | 663.75200 |
| Exact Mass | 663.32500 |
| PSA | 149.47000 |
| LogP | 3.52350 |
| InChIKey | VYXGUCLTEWCVRY-UHFFFAOYSA-N |
| SMILES | O=C(O)CCOCCOCCOCCOCCOCCOCCOCCOCCNC(=O)OCC1c2ccccc2-c2ccccc21 |
| Storage condition | 2-8°C, Seal |
| Water Solubility | Slightly soluble (2.5 g/L) (25 ºC) |
| 5,8,11,14,17,20,23,26-Octaoxa-2-azanonacosanedioic acid, 1-(9H-fluoren-9-ylmethyl) ester |
| 1-(9H-fluoren-9-yl)-3-oxo-2,7,10,13,16,19,22,25,28-nonaoxa-4-azahentriacontan-31-oic acid |
| Fmoc-N-amido-PEG8-acid |