Arbutin structure
|
Common Name | Arbutin | ||
|---|---|---|---|---|
| CAS Number | 497-76-7 | Molecular Weight | 272.251 | |
| Density | 1.6±0.1 g/cm3 | Boiling Point | 561.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C12H16O7 | Melting Point | 195-198 °C | |
| MSDS | Chinese USA | Flash Point | 293.4±30.1 °C | |
Use of ArbutinArbutin(β-Arbutin) is a glycoside; a glycosylated hydroquinone extracted from the bearberry plant in the genus Arctostaphylos; inhibits tyrosinase and thus prevents the formation of melanin.IC50 value:Target: tyrosinase |
| Name | hydroquinone O-β-D-glucopyranoside |
|---|---|
| Synonym | More Synonyms |
| Description | Arbutin(β-Arbutin) is a glycoside; a glycosylated hydroquinone extracted from the bearberry plant in the genus Arctostaphylos; inhibits tyrosinase and thus prevents the formation of melanin.IC50 value:Target: tyrosinase |
|---|---|
| Related Catalog | |
| References |
| Density | 1.6±0.1 g/cm3 |
|---|---|
| Boiling Point | 561.6±50.0 °C at 760 mmHg |
| Melting Point | 195-198 °C |
| Molecular Formula | C12H16O7 |
| Molecular Weight | 272.251 |
| Flash Point | 293.4±30.1 °C |
| Exact Mass | 272.089600 |
| PSA | 119.61000 |
| LogP | -1.35 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.650 |
| InChIKey | BJRNKVDFDLYUGJ-RMPHRYRLSA-N |
| SMILES | OCC1OC(Oc2ccc(O)cc2)C(O)C(O)C1O |
| Water Solubility | 10-15 g/100 mL at 20 ºC |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xn |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | CE8863000 |
| HS Code | 29389090 |
| Precursor 8 | |
|---|---|
| DownStream 6 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Change in chemical constituents and free radical-scavenging activity during Pear (Pyrus pyrifolia) cultivar fruit development.
Biosci. Biotechnol. Biochem. 79(2) , 260-70, (2015) Changes in chemical constituent contents and DPPH radical-scavenging activity in fruits of pear (Pyrus pyrifolia) cultivars during the development were investigated. The fruits of seven cultivars (cv.... |
|
|
Cellular Anti-Melanogenic Effects of a Euryale ferox Seed Extract Ethyl Acetate Fraction via the Lysosomal Degradation Machinery.
Int. J. Mol. Sci. 16 , 9217-35, (2015) The aim of this study was to investigate the effect of ethyl acetate fraction of Euryale ferox seed extracts (Efse-EA) on melanogenesis in immortalized mouse melanocyte cell line, melan-a. Efse-EA sho... |
|
|
Avocado Proanthocyanidins as a Source of Tyrosinase Inhibitors: Structure Characterization, Inhibitory Activity, and Mechanism.
J. Agric. Food Chem. 63 , 7381-7, (2015) Proanthocyanidins were purified from avocado (Persea americana) fruit, and their structures were analyzed by matrix-assisted laser desorption/ionization-time-of-flight mass spectrometry (MALDI-TOF MS)... |
| Ericolin) |
| 4-Hydroxyphenyl β-D-glucopyranoside |
| Uresol |
| Hydroquinone-β-D-glucoside |
| EINECS 207-850-3 |
| Hydroquinone-b-D-glucopyranoside |
| p-Hydroxyphenyl β-D-glucopyranoside |
| Hydroquinone-β-D-glucopyranoside |
| Hydroquinoneβ-D-glucopyranoside |
| hydroquinone O-beta-D-glucopyranoside |
| UVASOL |
| Arbutosie |
| MFCD00016915 |
| P-ARBUTIN |
| β-D-Glucopyranoside, 4-hydroxyphenyl |
| 4-Hydroxyphenyl-β-D-glucopyranosidep |
| 4-Hydroxyphenyl-β-glucopyranoside |
| 4-Hydroxyphenyl Beta-D-Glucopyranoside |
| (2R,3S,4S,5R,6S)-2-(Hydroxymethyl)-6-(4-hydroxyphenoxy)tetrahydro-2H-pyran-3,4,5-triol |
| b-Arbutin |
| Arbutin |
| 4-Hydroxyphenyl-β-D-glucopyranoside |
| hydroquinone O-β-D-glucopyranoside |
| URSIN |
| (2R,3S,4S,5R,6S)-2-(Hydroxyméthyl)-6-(4-hydroxyphénoxy)tétrahydro-2H-pyran-3,4,5-triol |
| 4-Hydroxyphenyl-b-D-glucopyranoside |
| ARBUTOSIDE |