Antitrypanosomal agent 2 structure
|
Common Name | Antitrypanosomal agent 2 | ||
|---|---|---|---|---|
| CAS Number | 475626-30-3 | Molecular Weight | 335.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H13N5O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Antitrypanosomal agent 2Antitrypanosomal agent 2 is a potent and selective trypanosoma brucei inhibitor[1]. |
| Name | Antitrypanosomal agent 2 |
|---|
| Description | Antitrypanosomal agent 2 is a potent and selective trypanosoma brucei inhibitor[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: parasite |
| Molecular Formula | C17H13N5O3 |
|---|---|
| Molecular Weight | 335.32 |
| InChIKey | PQFSMDQCXMNEHD-UHFFFAOYSA-N |
| SMILES | N#CCCn1cc(C=C2C(=O)NC(=O)NC2=O)c(-c2ccccc2)n1 |