mTOR inhibitor-1
Modify Date: 2025-08-25 18:42:27
mTOR inhibitor-1 structure
|
Common Name | mTOR inhibitor-1 | ||
|---|---|---|---|---|
| CAS Number | 468747-17-3 | Molecular Weight | 363.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15BrN2O3 | Melting Point | 262 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of mTOR inhibitor-1mTOR inhibitor-1 is a novel mTOR pathway inhibitor which can suppress cells proliferation and inducing autophagy. |
| Name | mTOR inhibitor-1 |
|---|
| Description | mTOR inhibitor-1 is a novel mTOR pathway inhibitor which can suppress cells proliferation and inducing autophagy. |
|---|---|
| Related Catalog | |
| Target |
mTOR[1] |
| References |
| Melting Point | 262 °C |
|---|---|
| Molecular Formula | C16H15BrN2O3 |
| Molecular Weight | 363.21 |
| InChIKey | NKMSVTGHOVMMHV-ZDLGFXPLSA-N |
| SMILES | CC(=NNC(=O)c1ccc(C)c(Br)c1)c1ccc(O)cc1O |