TNF-α-IN-1
Modify Date: 2025-08-22 20:00:19
TNF-α-IN-1 structure
|
Common Name | TNF-α-IN-1 | ||
|---|---|---|---|---|
| CAS Number | 444287-49-4 | Molecular Weight | 363.753 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 718.6±60.0 °C at 760 mmHg | |
| Molecular Formula | C16H14ClN3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 388.4±32.9 °C | |
Use of TNF-α-IN-1TNF-α-IN-1 is a TNF-α inhibitor extracted from patent US20030096841A1, compound example I-7. |
| Name | TNF-α-IN-1 |
|---|---|
| Synonym | More Synonyms |
| Description | TNF-α-IN-1 is a TNF-α inhibitor extracted from patent US20030096841A1, compound example I-7. |
|---|---|
| Related Catalog | |
| Target |
TNF-α[1] |
| References |
[1]. Robarge M, et al. Isoindole-imide compounds, compositions, and uses thereof. US20030096841A1 |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 718.6±60.0 °C at 760 mmHg |
| Molecular Formula | C16H14ClN3O5 |
| Molecular Weight | 363.753 |
| Flash Point | 388.4±32.9 °C |
| Exact Mass | 363.062195 |
| LogP | -0.66 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.632 |
| InChIKey | XRAYWKDMFVKUTJ-UHFFFAOYSA-N |
| SMILES | O=C(CCl)NCc1cccc2c1C(=O)N(C1CCC(=O)NC1=O)C2=O |
| Acetamide, 2-chloro-N-[[2-(2,6-dioxo-3-piperidinyl)-2,3-dihydro-1,3-dioxo-1H-isoindol-4-yl]methyl]- |
| 2-Chloro-N-{[2-(2,6-dioxo-3-piperidinyl)-1,3-dioxo-2,3-dihydro-1H-isoindol-4-yl]methyl}acetamide |