4-octyloxybenzoyl chloride structure
|
Common Name | 4-octyloxybenzoyl chloride | ||
|---|---|---|---|---|
| CAS Number | 40782-53-4 | Molecular Weight | 268.77900 | |
| Density | 1.252 g/mL at 25 °C(lit.) | Boiling Point | 129 °C(lit.) | |
| Molecular Formula | C15H21ClO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 150 °F | |
| Name | 4-octoxybenzoyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.252 g/mL at 25 °C(lit.) |
|---|---|
| Boiling Point | 129 °C(lit.) |
| Molecular Formula | C15H21ClO2 |
| Molecular Weight | 268.77900 |
| Flash Point | 150 °F |
| Exact Mass | 268.12300 |
| PSA | 26.30000 |
| LogP | 4.80490 |
| Index of Refraction | n20/D 1.62(lit.) |
| InChIKey | YXBOJGHBKKAPOG-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(C(=O)Cl)cc1 |
| Hazard Codes | Xi,Xn |
|---|---|
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . R36/38:Irritating to eyes and skin . R21/22:Harmful in contact with skin and if swallowed . R20/22:Harmful by inhalation and if swallowed . |
| Safety Phrases | S26-S36-S36/37/39 |
| RIDADR | UN3334 |
| WGK Germany | 3 |
| HS Code | 2918990090 |
| Precursor 10 | |
|---|---|
| DownStream 8 | |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-(n-octyloxy)benzoyl chloride |
| p-octyloxy benzoic acid chloride |
| 4-(n-octyloxy)bezoyl chloride |
| MFCD00799348 |
| 4-n-octyloxybenzoic acid chloride |
| 4-n-octyloxybenzoic chloride |
| 4-octyloxy benzoyl chloride |
| p-1S-methylheptyloxy benzoylchloride |